C19H20N4O2 — CID 99816453
1-(1-ethylindazol-6-yl)-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 99816453) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 1-(1-ethylindazol-6-yl)-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | 1-(1-ethylindazol-6-yl)-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 99816453 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-(1-ethylindazol-6-yl)-3-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | CCn1ncc2ccc(NC(=O)N[C@H]3c4ccccc4C[C@H]3O)cc21 |
| InChI | InChI=1S/C19H20N4O2/c1-2-23-16-10-14(8-7-13(16)11-20-23)21-19(25)22-18-15-6-4-3-5-12(15)9-17(18)24/h3-8,10-11,17-18,24H,2,9H2,1H3,(H2,21,22,25)/t17-,18+/m1/s1 |
| InChIKey | HWTDTSBJGGTTQO-MSOLQXFVSA-N |
| XLogP | 2.84 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |