C12H20F3N3 — CID 99816799
(3S)-N-ethyl-N'-prop-2-enyl-3-(trifluoromethyl)piperidine-1-carboximidamide (PubChem CID 99816799) has the molecular formula C12H20F3N3 and a molecular weight of 263.31 g/mol. Its IUPAC name is (3S)-N-ethyl-N'-prop-2-enyl-3-(trifluoromethyl)piperidine-1-carboximidamide.
| Compound Name | (3S)-N-ethyl-N'-prop-2-enyl-3-(trifluoromethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 99816799 |
| Molecular Formula | C12H20F3N3 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (3S)-N-ethyl-N'-prop-2-enyl-3-(trifluoromethyl)piperidine-1-carboximidamide |
| SMILES | C=CC/N=C(\NCC)N1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3N3/c1-3-7-17-11(16-4-2)18-8-5-6-10(9-18)12(13,14)15/h3,10H,1,4-9H2,2H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | YAJOADQTHKZPPC-JTQLQIEISA-N |
| XLogP | 2.41 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|