C20H21N3O3S — CID 99817710
3-(2-methoxyphenyl)-5-[(4-methylphenyl)methylsulfonyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 99817710) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-5-[(4-methylphenyl)methylsulfonyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(2-methoxyphenyl)-5-[(4-methylphenyl)methylsulfonyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 99817710 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3-(2-methoxyphenyl)-5-[(4-methylphenyl)methylsulfonyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(-c2ccccc2OC)nnc1S(=O)(=O)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C20H21N3O3S/c1-4-13-23-19(17-7-5-6-8-18(17)26-3)21-22-20(23)27(24,25)14-16-11-9-15(2)10-12-16/h4-12H,1,13-14H2,2-3H3 |
| InChIKey | YMFLLKKQRDJQSB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|