C17H16F3N3O — CID 99819260
(1'S,3R)-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxamide (PubChem CID 99819260) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is (1'S,3R)-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxamide.
| Compound Name | (1'S,3R)-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxamide |
|---|---|
| PubChem CID | 99819260 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (1'S,3R)-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxamide |
| SMILES | O=C(Nc1ccn(CC(F)(F)F)n1)[C@H]1C[C@]12CCc1ccccc12 |
| InChI | InChI=1S/C17H16F3N3O/c18-17(19,20)10-23-8-6-14(22-23)21-15(24)13-9-16(13)7-5-11-3-1-2-4-12(11)16/h1-4,6,8,13H,5,7,9-10H2,(H,21,22,24)/t13-,16+/m1/s1 |
| InChIKey | SZWPLGFVXGFDGG-CJNGLKHVSA-N |
| XLogP | 3.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |