About 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide
1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide (PubChem CID 99819560) has the molecular formula C18H30N4O2
and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide |
| PubChem CID | 99819560 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCN2CCOCC2(C)C)cnn1C1CCCC1 |
| InChI | InChI=1S/C18H30N4O2/c1-14-16(12-20-22(14)15-6-4-5-7-15)17(23)19-8-9-21-10-11-24-13-18(21,2)3/h12,15H,4-11,13H2,1-3H3,(H,19,23) |
| InChIKey | HHEDXESFRMCHMI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide?
The IUPAC name of 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide (CID 99819560) is 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide.
What is the SMILES notation for 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide?
The canonical SMILES for 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide is Cc1c(C(=O)NCCN2CCOCC2(C)C)cnn1C1CCCC1.
What is the InChIKey of 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide?
The InChIKey is HHEDXESFRMCHMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N4O2/c1-14-16(12-20-22(14)15-6-4-5-7-15)17(23)19-8-9-21-10-11-24-13-18(21,2)3/h12,15H,4-11,13H2,1-3H3,(H,19,23).
What are the key properties of 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide?
1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide has a molecular weight of 334.46 g/mol, XLogP of 2.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-5-methylpyrazole-4-carboxamide is sourced from PubChem (CID 99819560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).