About N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide
N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide (PubChem CID 99819845) has the molecular formula C18H19N3O4S
and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide |
| PubChem CID | 99819845 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc([C@@H](C)NS(=O)(=O)Cc2noc3ccccc23)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-12(14-6-5-7-15(10-14)19-13(2)22)21-26(23,24)11-17-16-8-3-4-9-18(16)25-20-17/h3-10,12,21H,11H2,1-2H3,(H,19,22)/t12-/m1/s1 |
| InChIKey | YTIACQIWDPQTKG-GFCCVEGCSA-N |
| XLogP | 2.97 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide?
The IUPAC name of N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide (CID 99819845) is N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide.
What is the SMILES notation for N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide?
The canonical SMILES for N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide is CC(=O)Nc1cccc([C@@H](C)NS(=O)(=O)Cc2noc3ccccc23)c1.
What is the InChIKey of N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide?
The InChIKey is YTIACQIWDPQTKG-GFCCVEGCSA-N. The full InChI is InChI=1S/C18H19N3O4S/c1-12(14-6-5-7-15(10-14)19-13(2)22)21-26(23,24)11-17-16-8-3-4-9-18(16)25-20-17/h3-10,12,21H,11H2,1-2H3,(H,19,22)/t12-/m1/s1.
What are the key properties of N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide?
N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide has a molecular weight of 373.43 g/mol, XLogP of 2.97, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(1R)-1-(1,2-benzoxazol-3-ylmethylsulfonylamino)ethyl]phenyl]acetamide is sourced from PubChem (CID 99819845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).