C16H28N4O — CID 99820341
1-(furan-2-ylmethyl)-2-methyl-3-[(3S)-3-piperidin-1-ylbutyl]guanidine (PubChem CID 99820341) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-methyl-3-[(3S)-3-piperidin-1-ylbutyl]guanidine.
| Compound Name | 1-(furan-2-ylmethyl)-2-methyl-3-[(3S)-3-piperidin-1-ylbutyl]guanidine |
|---|---|
| PubChem CID | 99820341 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-methyl-3-[(3S)-3-piperidin-1-ylbutyl]guanidine |
| SMILES | C/N=C(/NCC[C@H](C)N1CCCCC1)NCc1ccco1 |
| InChI | InChI=1S/C16H28N4O/c1-14(20-10-4-3-5-11-20)8-9-18-16(17-2)19-13-15-7-6-12-21-15/h6-7,12,14H,3-5,8-11,13H2,1-2H3,(H2,17,18,19)/t14-/m0/s1 |
| InChIKey | PBMWVGUKUDRMKV-AWEZNQCLSA-N |
| XLogP | 2.21 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|