C15H18BrNO3 — CID 99820700
(3R)-3-[[[(1R)-1-(5-bromo-1-benzofuran-2-yl)ethyl]amino]methyl]oxolan-3-ol (PubChem CID 99820700) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is (3R)-3-[[[(1R)-1-(5-bromo-1-benzofuran-2-yl)ethyl]amino]methyl]oxolan-3-ol.
| Compound Name | (3R)-3-[[[(1R)-1-(5-bromo-1-benzofuran-2-yl)ethyl]amino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 99820700 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (3R)-3-[[[(1R)-1-(5-bromo-1-benzofuran-2-yl)ethyl]amino]methyl]oxolan-3-ol |
| SMILES | C[C@@H](NC[C@]1(O)CCOC1)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C15H18BrNO3/c1-10(17-8-15(18)4-5-19-9-15)14-7-11-6-12(16)2-3-13(11)20-14/h2-3,6-7,10,17-18H,4-5,8-9H2,1H3/t10-,15-/m1/s1 |
| InChIKey | XKTKINUAEFXICG-MEBBXXQBSA-N |
| XLogP | 3.00 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |