C17H27N5O — CID 99821034
(2S)-N-(1-prop-2-enylpiperidin-4-yl)-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide (PubChem CID 99821034) has the molecular formula C17H27N5O and a molecular weight of 317.44 g/mol. Its IUPAC name is (2S)-N-(1-prop-2-enylpiperidin-4-yl)-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide.
| Compound Name | (2S)-N-(1-prop-2-enylpiperidin-4-yl)-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 99821034 |
| Molecular Formula | C17H27N5O |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | (2S)-N-(1-prop-2-enylpiperidin-4-yl)-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide |
| SMILES | C=CCN1CCC(NC(=O)N2CCCC[C@H]2c2cn[nH]c2)CC1 |
| InChI | InChI=1S/C17H27N5O/c1-2-8-21-10-6-15(7-11-21)20-17(23)22-9-4-3-5-16(22)14-12-18-19-13-14/h2,12-13,15-16H,1,3-11H2,(H,18,19)(H,20,23)/t16-/m0/s1 |
| InChIKey | GNJLEKYXDGUBKY-INIZCTEOSA-N |
| XLogP | 2.30 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|