C15H27NO2 — CID 99821470
[(1R,4S)-4-[[(1S,3S)-2,2-diethyl-3-methoxycyclobutyl]amino]cyclopent-2-en-1-yl]methanol (PubChem CID 99821470) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is [(1R,4S)-4-[[(1S,3S)-2,2-diethyl-3-methoxycyclobutyl]amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[[(1S,3S)-2,2-diethyl-3-methoxycyclobutyl]amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 99821470 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | [(1R,4S)-4-[[(1S,3S)-2,2-diethyl-3-methoxycyclobutyl]amino]cyclopent-2-en-1-yl]methanol |
| SMILES | CCC1(CC)[C@@H](N[C@@H]2C=C[C@H](CO)C2)C[C@@H]1OC |
| InChI | InChI=1S/C15H27NO2/c1-4-15(5-2)13(9-14(15)18-3)16-12-7-6-11(8-12)10-17/h6-7,11-14,16-17H,4-5,8-10H2,1-3H3/t11-,12+,13-,14-/m0/s1 |
| InChIKey | RXSQLXUHNKDBJU-CRWXNKLISA-N |
| XLogP | 2.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|