C17H28N2O2S — CID 99822457
(2R)-1-(4-methylphenyl)sulfonyl-N-[[(3R)-1-methylpiperidin-3-yl]methyl]propan-2-amine (PubChem CID 99822457) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is (2R)-1-(4-methylphenyl)sulfonyl-N-[[(3R)-1-methylpiperidin-3-yl]methyl]propan-2-amine.
| Compound Name | (2R)-1-(4-methylphenyl)sulfonyl-N-[[(3R)-1-methylpiperidin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 99822457 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (2R)-1-(4-methylphenyl)sulfonyl-N-[[(3R)-1-methylpiperidin-3-yl]methyl]propan-2-amine |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H](C)NC[C@H]2CCCN(C)C2)cc1 |
| InChI | InChI=1S/C17H28N2O2S/c1-14-6-8-17(9-7-14)22(20,21)13-15(2)18-11-16-5-4-10-19(3)12-16/h6-9,15-16,18H,4-5,10-13H2,1-3H3/t15-,16-/m1/s1 |
| InChIKey | MKWYNDLQRWKLLS-HZPDHXFCSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |