About (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one
(3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one (PubChem CID 99822908) has the molecular formula C14H20N6O
and a molecular weight of 288.36 g/mol. Its IUPAC name is (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one |
| PubChem CID | 99822908 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one |
| SMILES | CCn1cc(N[C@@H]2CCN(c3cc(C)nn3C)C2=O)cn1 |
| InChI | InChI=1S/C14H20N6O/c1-4-19-9-11(8-15-19)16-12-5-6-20(14(12)21)13-7-10(2)17-18(13)3/h7-9,12,16H,4-6H2,1-3H3/t12-/m1/s1 |
| InChIKey | WRNRMWABWGBTGW-GFCCVEGCSA-N |
| XLogP | 1.16 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one?
The IUPAC name of (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one (CID 99822908) is (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one.
What is the SMILES notation for (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one?
The canonical SMILES for (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one is CCn1cc(N[C@@H]2CCN(c3cc(C)nn3C)C2=O)cn1.
What is the InChIKey of (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one?
The InChIKey is WRNRMWABWGBTGW-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H20N6O/c1-4-19-9-11(8-15-19)16-12-5-6-20(14(12)21)13-7-10(2)17-18(13)3/h7-9,12,16H,4-6H2,1-3H3/t12-/m1/s1.
What are the key properties of (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one?
(3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one has a molecular weight of 288.36 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2,5-dimethylpyrazol-3-yl)-3-[(1-ethylpyrazol-4-yl)amino]pyrrolidin-2-one is sourced from PubChem (CID 99822908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).