C14H14F3N3O3 — CID 99823011
2,4,5-trifluoro-3-hydroxy-N-[(1S)-2-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]benzamide (PubChem CID 99823011) has the molecular formula C14H14F3N3O3 and a molecular weight of 329.28 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-hydroxy-N-[(1S)-2-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]benzamide.
| Compound Name | 2,4,5-trifluoro-3-hydroxy-N-[(1S)-2-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]benzamide |
|---|---|
| PubChem CID | 99823011 |
| Molecular Formula | C14H14F3N3O3 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2,4,5-trifluoro-3-hydroxy-N-[(1S)-2-methyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]benzamide |
| SMILES | Cc1noc([C@@H](NC(=O)c2cc(F)c(F)c(O)c2F)C(C)C)n1 |
| InChI | InChI=1S/C14H14F3N3O3/c1-5(2)11(14-18-6(3)20-23-14)19-13(22)7-4-8(15)10(17)12(21)9(7)16/h4-5,11,21H,1-3H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | LANYNTNDJJMSBN-NSHDSACASA-N |
| XLogP | 2.63 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|