C19H24N2O3 — CID 99823283
(5S)-3-[(4-phenylcyclohexyl)methyl]-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 99823283) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is (5S)-3-[(4-phenylcyclohexyl)methyl]-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5S)-3-[(4-phenylcyclohexyl)methyl]-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 99823283 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (5S)-3-[(4-phenylcyclohexyl)methyl]-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1N[C@]2(CCOC2)C(=O)N1CC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H24N2O3/c22-17-19(10-11-24-13-19)20-18(23)21(17)12-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-5,14,16H,6-13H2,(H,20,23)/t14?,16?,19-/m0/s1 |
| InChIKey | WPUBKBUSPWVGJM-KJXMEXGPSA-N |
| XLogP | 2.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|