C19H28N4O2 — CID 99823287
1-[(2S)-1-(1-oxophthalazin-2-yl)propan-2-yl]-3-(2,2,3-trimethylbutyl)urea (PubChem CID 99823287) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[(2S)-1-(1-oxophthalazin-2-yl)propan-2-yl]-3-(2,2,3-trimethylbutyl)urea.
| Compound Name | 1-[(2S)-1-(1-oxophthalazin-2-yl)propan-2-yl]-3-(2,2,3-trimethylbutyl)urea |
|---|---|
| PubChem CID | 99823287 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[(2S)-1-(1-oxophthalazin-2-yl)propan-2-yl]-3-(2,2,3-trimethylbutyl)urea |
| SMILES | CC(C)C(C)(C)CNC(=O)N[C@@H](C)Cn1ncc2ccccc2c1=O |
| InChI | InChI=1S/C19H28N4O2/c1-13(2)19(4,5)12-20-18(25)22-14(3)11-23-17(24)16-9-7-6-8-15(16)10-21-23/h6-10,13-14H,11-12H2,1-5H3,(H2,20,22,25)/t14-/m0/s1 |
| InChIKey | OYMREWDMKGZXSY-AWEZNQCLSA-N |
| XLogP | 2.77 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |