C14H22F2N2O — CID 99823380
[(3aS,4R,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4,4-difluorocyclohexyl)methanone (PubChem CID 99823380) has the molecular formula C14H22F2N2O and a molecular weight of 272.34 g/mol. Its IUPAC name is [(3aS,4R,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4,4-difluorocyclohexyl)methanone.
| Compound Name | [(3aS,4R,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4,4-difluorocyclohexyl)methanone |
|---|---|
| PubChem CID | 99823380 |
| Molecular Formula | C14H22F2N2O |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | [(3aS,4R,6aR)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4,4-difluorocyclohexyl)methanone |
| SMILES | N[C@@H]1CC[C@H]2CN(C(=O)C3CCC(F)(F)CC3)C[C@H]21 |
| InChI | InChI=1S/C14H22F2N2O/c15-14(16)5-3-9(4-6-14)13(19)18-7-10-1-2-12(17)11(10)8-18/h9-12H,1-8,17H2/t10-,11+,12+/m0/s1 |
| InChIKey | HGEGSWQJHZJXLK-QJPTWQEYSA-N |
| XLogP | 2.01 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |