About 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide
1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide (PubChem CID 99823906) has the molecular formula C16H26F2N4O3S
and a molecular weight of 392.47 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide |
| PubChem CID | 99823906 |
| Molecular Formula | C16H26F2N4O3S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1cnn(CC(F)F)c1)C1(N2CCOCC2)CCCC1 |
| InChI | InChI=1S/C16H26F2N4O3S/c1-13(16(4-2-3-5-16)21-6-8-25-9-7-21)20-26(23,24)14-10-19-22(11-14)12-15(17)18/h10-11,13,15,20H,2-9,12H2,1H3/t13-/m0/s1 |
| InChIKey | IYLKXPGFRQATDE-ZDUSSCGKSA-N |
| XLogP | 1.46 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide?
The IUPAC name of 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide (CID 99823906) is 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide.
What is the SMILES notation for 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide?
The canonical SMILES for 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide is C[C@H](NS(=O)(=O)c1cnn(CC(F)F)c1)C1(N2CCOCC2)CCCC1.
What is the InChIKey of 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide?
The InChIKey is IYLKXPGFRQATDE-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H26F2N4O3S/c1-13(16(4-2-3-5-16)21-6-8-25-9-7-21)20-26(23,24)14-10-19-22(11-14)12-15(17)18/h10-11,13,15,20H,2-9,12H2,1H3/t13-/m0/s1.
What are the key properties of 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide?
1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide has a molecular weight of 392.47 g/mol, XLogP of 1.46, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-N-[(1S)-1-(1-morpholin-4-ylcyclopentyl)ethyl]pyrazole-4-sulfonamide is sourced from PubChem (CID 99823906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).