C9H11F3N2O2 — CID 99824500
2-[(2S)-2-hydroxybutyl]-6-(trifluoromethyl)pyridazin-3-one (PubChem CID 99824500) has the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. Its IUPAC name is 2-[(2S)-2-hydroxybutyl]-6-(trifluoromethyl)pyridazin-3-one.
| Compound Name | 2-[(2S)-2-hydroxybutyl]-6-(trifluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 99824500 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-[(2S)-2-hydroxybutyl]-6-(trifluoromethyl)pyridazin-3-one |
| SMILES | CC[C@H](O)Cn1nc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C9H11F3N2O2/c1-2-6(15)5-14-8(16)4-3-7(13-14)9(10,11)12/h3-4,6,15H,2,5H2,1H3/t6-/m0/s1 |
| InChIKey | UOQYPBHSZRLUMB-LURJTMIESA-N |
| XLogP | 1.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |