About N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide
N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide (PubChem CID 99825117) has the molecular formula C12H15N3O3S2
and a molecular weight of 313.40 g/mol. Its IUPAC name is N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide |
| PubChem CID | 99825117 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCn1ncsc1=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-20(17,18)14(9-11-5-3-2-4-6-11)7-8-15-12(16)19-10-13-15/h2-6,10H,7-9H2,1H3 |
| InChIKey | HLCGLFCYEGZIRG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide?
The IUPAC name of N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide (CID 99825117) is N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide.
What is the SMILES notation for N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide?
The canonical SMILES for N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide is CS(=O)(=O)N(CCn1ncsc1=O)Cc1ccccc1.
What is the InChIKey of N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide?
The InChIKey is HLCGLFCYEGZIRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3S2/c1-20(17,18)14(9-11-5-3-2-4-6-11)7-8-15-12(16)19-10-13-15/h2-6,10H,7-9H2,1H3.
What are the key properties of N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide?
N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide has a molecular weight of 313.40 g/mol, XLogP of 0.77, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[2-(2-oxo-1,3,4-thiadiazol-3-yl)ethyl]methanesulfonamide is sourced from PubChem (CID 99825117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).