About propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate
propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate (PubChem CID 99825274) has the molecular formula C16H15F2NO3
and a molecular weight of 307.30 g/mol. Its IUPAC name is propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate |
| PubChem CID | 99825274 |
| Molecular Formula | C16H15F2NO3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate |
| SMILES | CC(C)OC(=O)c1ccn(Cc2cc(F)cc(F)c2)c(=O)c1 |
| InChI | InChI=1S/C16H15F2NO3/c1-10(2)22-16(21)12-3-4-19(15(20)7-12)9-11-5-13(17)8-14(18)6-11/h3-8,10H,9H2,1-2H3 |
| InChIKey | FWIVSMMMIRTMHF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate?
The IUPAC name of propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate (CID 99825274) is propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate.
What is the SMILES notation for propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate?
The canonical SMILES for propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate is CC(C)OC(=O)c1ccn(Cc2cc(F)cc(F)c2)c(=O)c1.
What is the InChIKey of propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate?
The InChIKey is FWIVSMMMIRTMHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2NO3/c1-10(2)22-16(21)12-3-4-19(15(20)7-12)9-11-5-13(17)8-14(18)6-11/h3-8,10H,9H2,1-2H3.
What are the key properties of propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate?
propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate has a molecular weight of 307.30 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 1-[(3,5-difluorophenyl)methyl]-2-oxopyridine-4-carboxylate is sourced from PubChem (CID 99825274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).