C16H11F3N2O2 — CID 99825349
1-[(3,5-difluorophenyl)methyl]-7-fluoro-6-methoxyquinazolin-4-one (PubChem CID 99825349) has the molecular formula C16H11F3N2O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-7-fluoro-6-methoxyquinazolin-4-one.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-7-fluoro-6-methoxyquinazolin-4-one |
|---|---|
| PubChem CID | 99825349 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-7-fluoro-6-methoxyquinazolin-4-one |
| SMILES | COc1cc2c(=O)ncn(Cc3cc(F)cc(F)c3)c2cc1F |
| InChI | InChI=1S/C16H11F3N2O2/c1-23-15-5-12-14(6-13(15)19)21(8-20-16(12)22)7-9-2-10(17)4-11(18)3-9/h2-6,8H,7H2,1H3 |
| InChIKey | AYFQWKLGDQGLCF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |