C12H14N4O4 — CID 99826098
5-[(3-ethoxy-4-nitrophenoxy)methyl]-1-methyl-1,2,4-triazole (PubChem CID 99826098) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 5-[(3-ethoxy-4-nitrophenoxy)methyl]-1-methyl-1,2,4-triazole.
| Compound Name | 5-[(3-ethoxy-4-nitrophenoxy)methyl]-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 99826098 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-[(3-ethoxy-4-nitrophenoxy)methyl]-1-methyl-1,2,4-triazole |
| SMILES | CCOc1cc(OCc2ncnn2C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N4O4/c1-3-19-11-6-9(4-5-10(11)16(17)18)20-7-12-13-8-14-15(12)2/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | CYPCWUAYDFONDJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|