C17H28F3N3O — CID 99826231
(4S)-3,3-dimethyl-N-(1-prop-2-enylpiperidin-4-yl)-4-(trifluoromethyl)piperidine-1-carboxamide (PubChem CID 99826231) has the molecular formula C17H28F3N3O and a molecular weight of 347.43 g/mol. Its IUPAC name is (4S)-3,3-dimethyl-N-(1-prop-2-enylpiperidin-4-yl)-4-(trifluoromethyl)piperidine-1-carboxamide.
| Compound Name | (4S)-3,3-dimethyl-N-(1-prop-2-enylpiperidin-4-yl)-4-(trifluoromethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 99826231 |
| Molecular Formula | C17H28F3N3O |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (4S)-3,3-dimethyl-N-(1-prop-2-enylpiperidin-4-yl)-4-(trifluoromethyl)piperidine-1-carboxamide |
| SMILES | C=CCN1CCC(NC(=O)N2CC[C@H](C(F)(F)F)C(C)(C)C2)CC1 |
| InChI | InChI=1S/C17H28F3N3O/c1-4-8-22-9-5-13(6-10-22)21-15(24)23-11-7-14(17(18,19)20)16(2,3)12-23/h4,13-14H,1,5-12H2,2-3H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | ZWJIQEZVMFXLRZ-AWEZNQCLSA-N |
| XLogP | 3.26 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|