C19H16N2O4 — CID 99827036
4-methyl-3-[(3S)-3-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carbonyl]chromen-2-one (PubChem CID 99827036) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-methyl-3-[(3S)-3-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carbonyl]chromen-2-one.
| Compound Name | 4-methyl-3-[(3S)-3-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 99827036 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-methyl-3-[(3S)-3-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carbonyl]chromen-2-one |
| SMILES | Cc1c(C(=O)N2C[C@H](C)Oc3ncccc32)c(=O)oc2ccccc12 |
| InChI | InChI=1S/C19H16N2O4/c1-11-10-21(14-7-5-9-20-17(14)24-11)18(22)16-12(2)13-6-3-4-8-15(13)25-19(16)23/h3-9,11H,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | NCCBGWYOAJWIJI-NSHDSACASA-N |
| XLogP | 2.92 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|