C16H29F3N2O2 — CID 99827539
(4R)-N-(5-hydroxy-4,4-dimethylpentyl)-3,3-dimethyl-4-(trifluoromethyl)piperidine-1-carboxamide (PubChem CID 99827539) has the molecular formula C16H29F3N2O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (4R)-N-(5-hydroxy-4,4-dimethylpentyl)-3,3-dimethyl-4-(trifluoromethyl)piperidine-1-carboxamide.
| Compound Name | (4R)-N-(5-hydroxy-4,4-dimethylpentyl)-3,3-dimethyl-4-(trifluoromethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 99827539 |
| Molecular Formula | C16H29F3N2O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (4R)-N-(5-hydroxy-4,4-dimethylpentyl)-3,3-dimethyl-4-(trifluoromethyl)piperidine-1-carboxamide |
| SMILES | CC(C)(CO)CCCNC(=O)N1CC[C@@H](C(F)(F)F)C(C)(C)C1 |
| InChI | InChI=1S/C16H29F3N2O2/c1-14(2,11-22)7-5-8-20-13(23)21-9-6-12(16(17,18)19)15(3,4)10-21/h12,22H,5-11H2,1-4H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | ULIMUIIETQMISV-GFCCVEGCSA-N |
| XLogP | 3.41 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|