C15H24F3N3O — CID 99827641
1-[(1R)-cyclohex-2-en-1-yl]-3-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]urea (PubChem CID 99827641) has the molecular formula C15H24F3N3O and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-[(1R)-cyclohex-2-en-1-yl]-3-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]urea.
| Compound Name | 1-[(1R)-cyclohex-2-en-1-yl]-3-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]urea |
|---|---|
| PubChem CID | 99827641 |
| Molecular Formula | C15H24F3N3O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-[(1R)-cyclohex-2-en-1-yl]-3-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]urea |
| SMILES | O=C(NCC1CCN(CC(F)(F)F)CC1)N[C@H]1C=CCCC1 |
| InChI | InChI=1S/C15H24F3N3O/c16-15(17,18)11-21-8-6-12(7-9-21)10-19-14(22)20-13-4-2-1-3-5-13/h2,4,12-13H,1,3,5-11H2,(H2,19,20,22)/t13-/m0/s1 |
| InChIKey | BGRLQRYKXGRWJR-ZDUSSCGKSA-N |
| XLogP | 2.67 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|