About [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate
[(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate (PubChem CID 99827704) has the molecular formula C13H11NO3
and a molecular weight of 229.24 g/mol. Its IUPAC name is [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate.
Molecular Properties
| Compound Name | [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate |
| PubChem CID | 99827704 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate |
| SMILES | O=C(O[C@@H]1CCc2cccnc21)c1ccoc1 |
| InChI | InChI=1S/C13H11NO3/c15-13(10-5-7-16-8-10)17-11-4-3-9-2-1-6-14-12(9)11/h1-2,5-8,11H,3-4H2/t11-/m1/s1 |
| InChIKey | LTOJPZNRRWFSKW-LLVKDONJSA-N |
| XLogP | 2.52 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate?
The IUPAC name of [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate (CID 99827704) is [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate.
What is the SMILES notation for [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate?
The canonical SMILES for [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate is O=C(O[C@@H]1CCc2cccnc21)c1ccoc1.
What is the InChIKey of [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate?
The InChIKey is LTOJPZNRRWFSKW-LLVKDONJSA-N. The full InChI is InChI=1S/C13H11NO3/c15-13(10-5-7-16-8-10)17-11-4-3-9-2-1-6-14-12(9)11/h1-2,5-8,11H,3-4H2/t11-/m1/s1.
What are the key properties of [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate?
[(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate has a molecular weight of 229.24 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl] furan-3-carboxylate is sourced from PubChem (CID 99827704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).