C9H11ClF4N2O — CID 99827721
4-chloro-5-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrazole (PubChem CID 99827721) has the molecular formula C9H11ClF4N2O and a molecular weight of 274.64 g/mol. Its IUPAC name is 4-chloro-5-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrazole.
| Compound Name | 4-chloro-5-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrazole |
|---|---|
| PubChem CID | 99827721 |
| Molecular Formula | C9H11ClF4N2O |
| Molecular Weight | 274.64 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-chloro-5-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrazole |
| SMILES | Cc1c(Cl)cnn1CCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H11ClF4N2O/c1-6-7(10)4-15-16(6)2-3-17-5-9(13,14)8(11)12/h4,8H,2-3,5H2,1H3 |
| InChIKey | AWTHJXQPJOLPII-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.64 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|