About 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea
3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea (PubChem CID 99827848) has the molecular formula C19H23N3OS
and a molecular weight of 341.48 g/mol. Its IUPAC name is 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea.
Molecular Properties
| Compound Name | 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea |
| PubChem CID | 99827848 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea |
| SMILES | CN(CC1(c2ccccc2)CC1)C(=O)NCc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C19H23N3OS/c1-22(13-19(9-10-19)15-5-3-2-4-6-15)18(23)20-11-17-21-16(12-24-17)14-7-8-14/h2-6,12,14H,7-11,13H2,1H3,(H,20,23) |
| InChIKey | GKPABIWGJMCXQX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea?
The IUPAC name of 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea (CID 99827848) is 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea.
What is the SMILES notation for 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea?
The canonical SMILES for 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea is CN(CC1(c2ccccc2)CC1)C(=O)NCc1nc(C2CC2)cs1.
What is the InChIKey of 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea?
The InChIKey is GKPABIWGJMCXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3OS/c1-22(13-19(9-10-19)15-5-3-2-4-6-15)18(23)20-11-17-21-16(12-24-17)14-7-8-14/h2-6,12,14H,7-11,13H2,1H3,(H,20,23).
What are the key properties of 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea?
3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea has a molecular weight of 341.48 g/mol, XLogP of 3.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-cyclopropyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea is sourced from PubChem (CID 99827848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).