About (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one
(3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one (PubChem CID 99828112) has the molecular formula C17H28N4OS
and a molecular weight of 336.51 g/mol. Its IUPAC name is (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one.
Molecular Properties
| Compound Name | (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one |
| PubChem CID | 99828112 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one |
| SMILES | CCS[C@@H]1CCCC[C@@H]1N[C@@H]1CCCN(c2cnn(C)c2)C1=O |
| InChI | InChI=1S/C17H28N4OS/c1-3-23-16-9-5-4-7-14(16)19-15-8-6-10-21(17(15)22)13-11-18-20(2)12-13/h11-12,14-16,19H,3-10H2,1-2H3/t14-,15+,16+/m0/s1 |
| InChIKey | ZBQUWXVVDYQYBW-ARFHVFGLSA-N |
| XLogP | 2.57 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one?
The IUPAC name of (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one (CID 99828112) is (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one.
What is the SMILES notation for (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one?
The canonical SMILES for (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one is CCS[C@@H]1CCCC[C@@H]1N[C@@H]1CCCN(c2cnn(C)c2)C1=O.
What is the InChIKey of (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one?
The InChIKey is ZBQUWXVVDYQYBW-ARFHVFGLSA-N. The full InChI is InChI=1S/C17H28N4OS/c1-3-23-16-9-5-4-7-14(16)19-15-8-6-10-21(17(15)22)13-11-18-20(2)12-13/h11-12,14-16,19H,3-10H2,1-2H3/t14-,15+,16+/m0/s1.
What are the key properties of (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one?
(3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one has a molecular weight of 336.51 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[[(1S,2R)-2-ethylsulfanylcyclohexyl]amino]-1-(1-methylpyrazol-4-yl)piperidin-2-one is sourced from PubChem (CID 99828112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).