C18H26N2O2 — CID 99828934
1-[(4-cyclopropylphenyl)methyl]-3-[(2S,6S)-2,6-dimethyloxan-4-yl]urea (PubChem CID 99828934) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[(4-cyclopropylphenyl)methyl]-3-[(2S,6S)-2,6-dimethyloxan-4-yl]urea.
| Compound Name | 1-[(4-cyclopropylphenyl)methyl]-3-[(2S,6S)-2,6-dimethyloxan-4-yl]urea |
|---|---|
| PubChem CID | 99828934 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-[(4-cyclopropylphenyl)methyl]-3-[(2S,6S)-2,6-dimethyloxan-4-yl]urea |
| SMILES | C[C@H]1CC(NC(=O)NCc2ccc(C3CC3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C18H26N2O2/c1-12-9-17(10-13(2)22-12)20-18(21)19-11-14-3-5-15(6-4-14)16-7-8-16/h3-6,12-13,16-17H,7-11H2,1-2H3,(H2,19,20,21)/t12-,13-/m0/s1 |
| InChIKey | AWQHWIONRRNCEX-STQMWFEESA-N |
| XLogP | 3.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |