C16H21N3O2 — CID 99829231
2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(4-hydroxy-2,3,5-trimethylphenyl)acetamide (PubChem CID 99829231) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(4-hydroxy-2,3,5-trimethylphenyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(4-hydroxy-2,3,5-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 99829231 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(4-hydroxy-2,3,5-trimethylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)Cc2c(C)n[nH]c2C)c(C)c(C)c1O |
| InChI | InChI=1S/C16H21N3O2/c1-8-6-14(9(2)10(3)16(8)21)17-15(20)7-13-11(4)18-19-12(13)5/h6,21H,7H2,1-5H3,(H,17,20)(H,18,19) |
| InChIKey | SFIYXABLJAXGKN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|