About 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone
2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone (PubChem CID 99829955) has the molecular formula C14H12N2OS
and a molecular weight of 256.33 g/mol. Its IUPAC name is 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone |
| PubChem CID | 99829955 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CCC=Cc2ccccc21 |
| InChI | InChI=1S/C14H12N2OS/c17-14(12-9-18-10-15-12)16-8-4-3-6-11-5-1-2-7-13(11)16/h1-3,5-7,9-10H,4,8H2 |
| InChIKey | SDXMMZKYBJFSIB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone?
The IUPAC name of 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone (CID 99829955) is 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone.
What is the SMILES notation for 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone?
The canonical SMILES for 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone is O=C(c1cscn1)N1CCC=Cc2ccccc21.
What is the InChIKey of 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone?
The InChIKey is SDXMMZKYBJFSIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2OS/c17-14(12-9-18-10-15-12)16-8-4-3-6-11-5-1-2-7-13(11)16/h1-3,5-7,9-10H,4,8H2.
What are the key properties of 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone?
2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone has a molecular weight of 256.33 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1-benzazepin-1-yl(1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 99829955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).