About 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide
3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide (PubChem CID 99830070) has the molecular formula C12H18N4O2S
and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide |
| PubChem CID | 99830070 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide |
| SMILES | CC[C@H](NC(=O)N1CC(NC(C)=O)C1)c1nccs1 |
| InChI | InChI=1S/C12H18N4O2S/c1-3-10(11-13-4-5-19-11)15-12(18)16-6-9(7-16)14-8(2)17/h4-5,9-10H,3,6-7H2,1-2H3,(H,14,17)(H,15,18)/t10-/m0/s1 |
| InChIKey | WXNQYXFDVPGACQ-JTQLQIEISA-N |
| XLogP | 1.12 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide?
The IUPAC name of 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide (CID 99830070) is 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide.
What is the SMILES notation for 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide?
The canonical SMILES for 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide is CC[C@H](NC(=O)N1CC(NC(C)=O)C1)c1nccs1.
What is the InChIKey of 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide?
The InChIKey is WXNQYXFDVPGACQ-JTQLQIEISA-N. The full InChI is InChI=1S/C12H18N4O2S/c1-3-10(11-13-4-5-19-11)15-12(18)16-6-9(7-16)14-8(2)17/h4-5,9-10H,3,6-7H2,1-2H3,(H,14,17)(H,15,18)/t10-/m0/s1.
What are the key properties of 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide?
3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide has a molecular weight of 282.37 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-N-[(1S)-1-(1,3-thiazol-2-yl)propyl]azetidine-1-carboxamide is sourced from PubChem (CID 99830070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).