About 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea
1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea (PubChem CID 99830189) has the molecular formula C16H30N2O3
and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea.
Molecular Properties
| Compound Name | 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea |
| PubChem CID | 99830189 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea |
| SMILES | CO[C@H]1CC[C@@H](NC(=O)NC2CCC(OC(C)C)CC2)C1 |
| InChI | InChI=1S/C16H30N2O3/c1-11(2)21-14-7-4-12(5-8-14)17-16(19)18-13-6-9-15(10-13)20-3/h11-15H,4-10H2,1-3H3,(H2,17,18,19)/t12?,13-,14?,15+/m1/s1 |
| InChIKey | PKWOMXSZLNZWTP-JYVUQVBGSA-N |
| XLogP | 2.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea?
The IUPAC name of 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea (CID 99830189) is 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea.
What is the SMILES notation for 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea?
The canonical SMILES for 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea is CO[C@H]1CC[C@@H](NC(=O)NC2CCC(OC(C)C)CC2)C1.
What is the InChIKey of 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea?
The InChIKey is PKWOMXSZLNZWTP-JYVUQVBGSA-N. The full InChI is InChI=1S/C16H30N2O3/c1-11(2)21-14-7-4-12(5-8-14)17-16(19)18-13-6-9-15(10-13)20-3/h11-15H,4-10H2,1-3H3,(H2,17,18,19)/t12?,13-,14?,15+/m1/s1.
What are the key properties of 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea?
1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea has a molecular weight of 298.43 g/mol, XLogP of 2.59, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,3S)-3-methoxycyclopentyl]-3-(4-propan-2-yloxycyclohexyl)urea is sourced from PubChem (CID 99830189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).