About (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide
(1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide (PubChem CID 99831303) has the molecular formula C16H24F2N2O3
and a molecular weight of 330.38 g/mol. Its IUPAC name is (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide.
Molecular Properties
| Compound Name | (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
| PubChem CID | 99831303 |
| Molecular Formula | C16H24F2N2O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
| SMILES | CCN(CC(F)F)C(=O)[C@@H]1CC=CC[C@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H24F2N2O3/c1-2-19(11-14(17)18)15(21)12-5-3-4-6-13(12)16(22)20-7-9-23-10-8-20/h3-4,12-14H,2,5-11H2,1H3/t12-,13-/m1/s1 |
| InChIKey | LJQPJGVIRICJRW-CHWSQXEVSA-N |
| XLogP | 1.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide?
The IUPAC name of (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide (CID 99831303) is (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide.
What is the SMILES notation for (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide?
The canonical SMILES for (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide is CCN(CC(F)F)C(=O)[C@@H]1CC=CC[C@H]1C(=O)N1CCOCC1.
What is the InChIKey of (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide?
The InChIKey is LJQPJGVIRICJRW-CHWSQXEVSA-N. The full InChI is InChI=1S/C16H24F2N2O3/c1-2-19(11-14(17)18)15(21)12-5-3-4-6-13(12)16(22)20-7-9-23-10-8-20/h3-4,12-14H,2,5-11H2,1H3/t12-,13-/m1/s1.
What are the key properties of (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide?
(1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide has a molecular weight of 330.38 g/mol, XLogP of 1.54, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6R)-N-(2,2-difluoroethyl)-N-ethyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide is sourced from PubChem (CID 99831303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).