C10H16N4O2S — CID 99831664
(3R)-3-(ethoxymethyl)-N-(thiadiazol-5-yl)pyrrolidine-1-carboxamide (PubChem CID 99831664) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is (3R)-3-(ethoxymethyl)-N-(thiadiazol-5-yl)pyrrolidine-1-carboxamide.
| Compound Name | (3R)-3-(ethoxymethyl)-N-(thiadiazol-5-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 99831664 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (3R)-3-(ethoxymethyl)-N-(thiadiazol-5-yl)pyrrolidine-1-carboxamide |
| SMILES | CCOC[C@@H]1CCN(C(=O)Nc2cnns2)C1 |
| InChI | InChI=1S/C10H16N4O2S/c1-2-16-7-8-3-4-14(6-8)10(15)12-9-5-11-13-17-9/h5,8H,2-4,6-7H2,1H3,(H,12,15)/t8-/m1/s1 |
| InChIKey | GBNNHVCDKFONOP-MRVPVSSYSA-N |
| XLogP | 1.43 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |