C17H27N3O2 — CID 99831815
1-[(2S)-2-cyclohexyl-2-hydroxypropyl]-3-(2-pyridin-3-ylethyl)urea (PubChem CID 99831815) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-[(2S)-2-cyclohexyl-2-hydroxypropyl]-3-(2-pyridin-3-ylethyl)urea.
| Compound Name | 1-[(2S)-2-cyclohexyl-2-hydroxypropyl]-3-(2-pyridin-3-ylethyl)urea |
|---|---|
| PubChem CID | 99831815 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 1-[(2S)-2-cyclohexyl-2-hydroxypropyl]-3-(2-pyridin-3-ylethyl)urea |
| SMILES | C[C@@](O)(CNC(=O)NCCc1cccnc1)C1CCCCC1 |
| InChI | InChI=1S/C17H27N3O2/c1-17(22,15-7-3-2-4-8-15)13-20-16(21)19-11-9-14-6-5-10-18-12-14/h5-6,10,12,15,22H,2-4,7-9,11,13H2,1H3,(H2,19,20,21)/t17-/m1/s1 |
| InChIKey | FVIXTYHQVIZHKF-QGZVFWFLSA-N |
| XLogP | 2.25 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |