About 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile
4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile (PubChem CID 99832232) has the molecular formula C10H10Cl2N2S
and a molecular weight of 261.18 g/mol. Its IUPAC name is 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile.
Molecular Properties
| Compound Name | 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile |
| PubChem CID | 99832232 |
| Molecular Formula | C10H10Cl2N2S |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile |
| SMILES | N#CCCCSCc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2N2S/c11-8-5-9(12)10(14-6-8)7-15-4-2-1-3-13/h5-6H,1-2,4,7H2 |
| InChIKey | AHVMVHRUGIHDIH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile?
The IUPAC name of 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile (CID 99832232) is 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile.
What is the SMILES notation for 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile?
The canonical SMILES for 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile is N#CCCCSCc1ncc(Cl)cc1Cl.
What is the InChIKey of 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile?
The InChIKey is AHVMVHRUGIHDIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2N2S/c11-8-5-9(12)10(14-6-8)7-15-4-2-1-3-13/h5-6H,1-2,4,7H2.
What are the key properties of 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile?
4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile has a molecular weight of 261.18 g/mol, XLogP of 3.93, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dichloro-2-pyridinyl)methylsulfanyl]butanenitrile is sourced from PubChem (CID 99832232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).