C16H26N4 — CID 99832402
1-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-4-(1,2,4-triazol-1-yl)piperidine (PubChem CID 99832402) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-4-(1,2,4-triazol-1-yl)piperidine.
| Compound Name | 1-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-4-(1,2,4-triazol-1-yl)piperidine |
|---|---|
| PubChem CID | 99832402 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 1-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-4-(1,2,4-triazol-1-yl)piperidine |
| SMILES | CC1=CCC[C@@H](C)[C@H]1CN1CCC(n2cncn2)CC1 |
| InChI | InChI=1S/C16H26N4/c1-13-4-3-5-14(2)16(13)10-19-8-6-15(7-9-19)20-12-17-11-18-20/h4,11-12,14-16H,3,5-10H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | PQOLHSWFDDBQRU-ZBFHGGJFSA-N |
| XLogP | 2.91 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|