C19H30N4 — CID 99832437
3-[(3S)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperidin-3-yl]-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole (PubChem CID 99832437) has the molecular formula C19H30N4 and a molecular weight of 314.48 g/mol. Its IUPAC name is 3-[(3S)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperidin-3-yl]-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole.
| Compound Name | 3-[(3S)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperidin-3-yl]-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole |
|---|---|
| PubChem CID | 99832437 |
| Molecular Formula | C19H30N4 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 3-[(3S)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperidin-3-yl]-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CN1CCC[C@H](c2nnc3n2CCC3)C1 |
| InChI | InChI=1S/C19H30N4/c1-14-6-3-7-15(2)17(14)13-22-10-4-8-16(12-22)19-21-20-18-9-5-11-23(18)19/h6,15-17H,3-5,7-13H2,1-2H3/t15-,16-,17+/m0/s1 |
| InChIKey | MNJMGDFYUIIOSS-YESZJQIVSA-N |
| XLogP | 3.40 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|