C15H25N3O — CID 99832502
(8aR)-7-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 99832502) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (8aR)-7-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | (8aR)-7-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 99832502 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (8aR)-7-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CC1=CCC[C@H](C)[C@H]1CN1CCN2C(=O)NC[C@@H]2C1 |
| InChI | InChI=1S/C15H25N3O/c1-11-4-3-5-12(2)14(11)10-17-6-7-18-13(9-17)8-16-15(18)19/h4,12-14H,3,5-10H2,1-2H3,(H,16,19)/t12-,13+,14-/m0/s1 |
| InChIKey | DVCHTSDRHWOKMQ-MJBXVCDLSA-N |
| XLogP | 1.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|