C17H25NO2S — CID 99832522
N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-2-(methylsulfonylmethyl)aniline (PubChem CID 99832522) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-2-(methylsulfonylmethyl)aniline.
| Compound Name | N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-2-(methylsulfonylmethyl)aniline |
|---|---|
| PubChem CID | 99832522 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-2-(methylsulfonylmethyl)aniline |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CNc1ccccc1CS(C)(=O)=O |
| InChI | InChI=1S/C17H25NO2S/c1-13-7-6-8-14(2)16(13)11-18-17-10-5-4-9-15(17)12-21(3,19)20/h4-5,7,9-10,14,16,18H,6,8,11-12H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | JQBLVDPOGLBTLI-GOEBONIOSA-N |
| XLogP | 3.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|