About (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide
(3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide (PubChem CID 99832796) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide.
Molecular Properties
| Compound Name | (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide |
| PubChem CID | 99832796 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide |
| SMILES | CC(C)=CC/N=C(\N)N1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C12H23N3/c1-10(2)6-7-14-12(13)15-8-4-5-11(3)9-15/h6,11H,4-5,7-9H2,1-3H3,(H2,13,14)/t11-/m1/s1 |
| InChIKey | IOQRGBAMTXJIEY-LLVKDONJSA-N |
| XLogP | 2.00 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide?
The IUPAC name of (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide (CID 99832796) is (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide.
What is the SMILES notation for (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide?
The canonical SMILES for (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide is CC(C)=CC/N=C(\N)N1CCC[C@@H](C)C1.
What is the InChIKey of (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide?
The InChIKey is IOQRGBAMTXJIEY-LLVKDONJSA-N. The full InChI is InChI=1S/C12H23N3/c1-10(2)6-7-14-12(13)15-8-4-5-11(3)9-15/h6,11H,4-5,7-9H2,1-3H3,(H2,13,14)/t11-/m1/s1.
What are the key properties of (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide?
(3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide has a molecular weight of 209.34 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methyl-N'-(3-methylbut-2-enyl)piperidine-1-carboximidamide is sourced from PubChem (CID 99832796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).