About 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide
3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide (PubChem CID 99832809) has the molecular formula C10H10INOS
and a molecular weight of 319.17 g/mol. Its IUPAC name is 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide |
| PubChem CID | 99832809 |
| Molecular Formula | C10H10INOS |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide |
| SMILES | C#CCN(C)C(=O)c1scc(C)c1I |
| InChI | InChI=1S/C10H10INOS/c1-4-5-12(3)10(13)9-8(11)7(2)6-14-9/h1,6H,5H2,2-3H3 |
| InChIKey | UYALQURMEHISEH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide?
The IUPAC name of 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide (CID 99832809) is 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide.
What is the SMILES notation for 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide?
The canonical SMILES for 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide is C#CCN(C)C(=O)c1scc(C)c1I.
What is the InChIKey of 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide?
The InChIKey is UYALQURMEHISEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10INOS/c1-4-5-12(3)10(13)9-8(11)7(2)6-14-9/h1,6H,5H2,2-3H3.
What are the key properties of 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide?
3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide has a molecular weight of 319.17 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-N,4-dimethyl-N-prop-2-ynylthiophene-2-carboxamide is sourced from PubChem (CID 99832809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).