C18H25N3O2 — CID 99833373
1-[(1S,3S)-3-methoxycyclopentyl]-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea (PubChem CID 99833373) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-[(1S,3S)-3-methoxycyclopentyl]-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-[(1S,3S)-3-methoxycyclopentyl]-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 99833373 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 1-[(1S,3S)-3-methoxycyclopentyl]-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea |
| SMILES | CO[C@H]1CC[C@H](NC(=O)NCCc2c(C)[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C18H25N3O2/c1-12-15(16-5-3-4-6-17(16)20-12)9-10-19-18(22)21-13-7-8-14(11-13)23-2/h3-6,13-14,20H,7-11H2,1-2H3,(H2,19,21,22)/t13-,14-/m0/s1 |
| InChIKey | ORNYJDKSECKMSS-KBPBESRZSA-N |
| XLogP | 2.89 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|