About 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one
1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one (PubChem CID 99833920) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one.
Molecular Properties
| Compound Name | 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one |
| PubChem CID | 99833920 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCC(c2n[nH]c(CC)n2)CC1 |
| InChI | InChI=1S/C14H22N4O/c1-3-5-6-13(19)18-9-7-11(8-10-18)14-15-12(4-2)16-17-14/h3,11H,1,4-10H2,2H3,(H,15,16,17) |
| InChIKey | ZQDVULZLVMSAFG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one?
The IUPAC name of 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one (CID 99833920) is 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one.
What is the SMILES notation for 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one?
The canonical SMILES for 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one is C=CCCC(=O)N1CCC(c2n[nH]c(CC)n2)CC1.
What is the InChIKey of 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one?
The InChIKey is ZQDVULZLVMSAFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O/c1-3-5-6-13(19)18-9-7-11(8-10-18)14-15-12(4-2)16-17-14/h3,11H,1,4-10H2,2H3,(H,15,16,17).
What are the key properties of 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one?
1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one has a molecular weight of 262.36 g/mol, XLogP of 2.04, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]pent-4-en-1-one is sourced from PubChem (CID 99833920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).