C12H19F2N5O2 — CID 99834017
1-[2-(2,2-difluoroethoxy)ethyl]-3-[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea (PubChem CID 99834017) has the molecular formula C12H19F2N5O2 and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethoxy)ethyl]-3-[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea.
| Compound Name | 1-[2-(2,2-difluoroethoxy)ethyl]-3-[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 99834017 |
| Molecular Formula | C12H19F2N5O2 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-[2-(2,2-difluoroethoxy)ethyl]-3-[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea |
| SMILES | Cc1nc2n(n1)C[C@H](NC(=O)NCCOCC(F)F)CC2 |
| InChI | InChI=1S/C12H19F2N5O2/c1-8-16-11-3-2-9(6-19(11)18-8)17-12(20)15-4-5-21-7-10(13)14/h9-10H,2-7H2,1H3,(H2,15,17,20)/t9-/m1/s1 |
| InChIKey | FQQZHMJYVDBGOK-SECBINFHSA-N |
| XLogP | 0.48 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|