About 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine
2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine (PubChem CID 99834657) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine |
| PubChem CID | 99834657 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine |
| SMILES | CC1(C)CCC[C@H]1NCc1nccc(N)n1 |
| InChI | InChI=1S/C12H20N4/c1-12(2)6-3-4-9(12)15-8-11-14-7-5-10(13)16-11/h5,7,9,15H,3-4,6,8H2,1-2H3,(H2,13,14,16)/t9-/m1/s1 |
| InChIKey | XGAFJGILUXAXQP-SECBINFHSA-N |
| XLogP | 1.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine?
The IUPAC name of 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine (CID 99834657) is 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine.
What is the SMILES notation for 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine?
The canonical SMILES for 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine is CC1(C)CCC[C@H]1NCc1nccc(N)n1.
What is the InChIKey of 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine?
The InChIKey is XGAFJGILUXAXQP-SECBINFHSA-N. The full InChI is InChI=1S/C12H20N4/c1-12(2)6-3-4-9(12)15-8-11-14-7-5-10(13)16-11/h5,7,9,15H,3-4,6,8H2,1-2H3,(H2,13,14,16)/t9-/m1/s1.
What are the key properties of 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine?
2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine has a molecular weight of 220.32 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[(1R)-2,2-dimethylcyclopentyl]amino]methyl]pyrimidin-4-amine is sourced from PubChem (CID 99834657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).