C13H20F5NO2S — CID 99834730
N-[(1S,3S)-3-methylsulfanylcyclohexyl]-3-(2,2,3,3,3-pentafluoropropoxy)propanamide (PubChem CID 99834730) has the molecular formula C13H20F5NO2S and a molecular weight of 349.37 g/mol. Its IUPAC name is N-[(1S,3S)-3-methylsulfanylcyclohexyl]-3-(2,2,3,3,3-pentafluoropropoxy)propanamide.
| Compound Name | N-[(1S,3S)-3-methylsulfanylcyclohexyl]-3-(2,2,3,3,3-pentafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 99834730 |
| Molecular Formula | C13H20F5NO2S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[(1S,3S)-3-methylsulfanylcyclohexyl]-3-(2,2,3,3,3-pentafluoropropoxy)propanamide |
| SMILES | CS[C@H]1CCC[C@H](NC(=O)CCOCC(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H20F5NO2S/c1-22-10-4-2-3-9(7-10)19-11(20)5-6-21-8-12(14,15)13(16,17)18/h9-10H,2-8H2,1H3,(H,19,20)/t9-,10-/m0/s1 |
| InChIKey | TVTWETMLNVSELD-UWVGGRQHSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|